C20H25N3O4 — CID 129278172
4-[[6-(2-phenylmethoxyethylamino)-3-pyridinyl]oxy]piperidine-1-carboxylic acid (PubChem CID 129278172) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[[6-(2-phenylmethoxyethylamino)-3-pyridinyl]oxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[[6-(2-phenylmethoxyethylamino)-3-pyridinyl]oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 129278172 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-[[6-(2-phenylmethoxyethylamino)-3-pyridinyl]oxy]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Oc2ccc(NCCOCc3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C20H25N3O4/c24-20(25)23-11-8-17(9-12-23)27-18-6-7-19(22-14-18)21-10-13-26-15-16-4-2-1-3-5-16/h1-7,14,17H,8-13,15H2,(H,21,22)(H,24,25) |
| InChIKey | INUPIULWYRCWDV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|