C31H43N3O4 — CID 129279826
tert-butyl N-[1-[2-(4-morpholin-4-ylphenoxy)ethyl]piperidin-4-yl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate (PubChem CID 129279826) has the molecular formula C31H43N3O4 and a molecular weight of 521.70 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(4-morpholin-4-ylphenoxy)ethyl]piperidin-4-yl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(4-morpholin-4-ylphenoxy)ethyl]piperidin-4-yl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 129279826 |
| Molecular Formula | C31H43N3O4 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | tert-butyl N-[1-[2-(4-morpholin-4-ylphenoxy)ethyl]piperidin-4-yl]-N-[(1R,2S)-2-phenylcyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCN(CCOc2ccc(N3CCOCC3)cc2)CC1)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H43N3O4/c1-31(2,3)38-30(35)34(29-23-28(29)24-7-5-4-6-8-24)26-13-15-32(16-14-26)17-22-37-27-11-9-25(10-12-27)33-18-20-36-21-19-33/h4-12,26,28-29H,13-23H2,1-3H3/t28-,29+/m0/s1 |
| InChIKey | ZYWNVCMVWVMBEO-URLMMPGGSA-N |
| XLogP | 5.16 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|