C25H25F3N4O3 — CID 129280287
3-[[6-[N-methyl-4-(2,2,2-trifluoroethoxy)anilino]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid (PubChem CID 129280287) has the molecular formula C25H25F3N4O3 and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-[[6-[N-methyl-4-(2,2,2-trifluoroethoxy)anilino]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-[[6-[N-methyl-4-(2,2,2-trifluoroethoxy)anilino]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 129280287 |
| Molecular Formula | C25H25F3N4O3 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-[[6-[N-methyl-4-(2,2,2-trifluoroethoxy)anilino]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid |
| SMILES | CN(c1ccc(OCC(F)(F)F)cc1)c1ccc2c(c1)CCNC2CNc1cnccc1C(=O)O |
| InChI | InChI=1S/C25H25F3N4O3/c1-32(17-2-5-19(6-3-17)35-15-25(26,27)28)18-4-7-20-16(12-18)8-11-30-23(20)14-31-22-13-29-10-9-21(22)24(33)34/h2-7,9-10,12-13,23,30-31H,8,11,14-15H2,1H3,(H,33,34) |
| InChIKey | SBICFIQBXIMMNN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|