C26H30N4O2 — CID 129280293
3-[[6-(N-methyl-4-propylanilino)-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid (PubChem CID 129280293) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-[[6-(N-methyl-4-propylanilino)-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-[[6-(N-methyl-4-propylanilino)-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 129280293 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-[[6-(N-methyl-4-propylanilino)-1,2,3,4-tetrahydroisoquinolin-1-yl]methylamino]pyridine-4-carboxylic acid |
| SMILES | CCCc1ccc(N(C)c2ccc3c(c2)CCNC3CNc2cnccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H30N4O2/c1-3-4-18-5-7-20(8-6-18)30(2)21-9-10-22-19(15-21)11-14-28-25(22)17-29-24-16-27-13-12-23(24)26(31)32/h5-10,12-13,15-16,25,28-29H,3-4,11,14,17H2,1-2H3,(H,31,32) |
| InChIKey | XOPWWZSKDBQXLK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|