C16H17FN2O — CID 129282641
2-(8-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)cyclohexan-1-ol (PubChem CID 129282641) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-(8-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)cyclohexan-1-ol.
| Compound Name | 2-(8-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 129282641 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(8-fluoro-5H-imidazo[5,1-a]isoindol-5-yl)cyclohexan-1-ol |
| SMILES | OC1CCCCC1C1c2ccc(F)cc2-c2cncn21 |
| InChI | InChI=1S/C16H17FN2O/c17-10-5-6-11-13(7-10)14-8-18-9-19(14)16(11)12-3-1-2-4-15(12)20/h5-9,12,15-16,20H,1-4H2 |
| InChIKey | HCSSHZJNTHXWER-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |