C13H14N2OS — CID 130360648
cis-(1S,2S)-2-[(7R)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraen-7-yl]cyclopentan-1-ol (PubChem CID 130360648) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is cis-(1S,2S)-2-[(7R)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraen-7-yl]cyclopentan-1-ol.
| Compound Name | cis-(1S,2S)-2-[(7R)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraen-7-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 130360648 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | cis-(1S,2S)-2-[(7R)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraen-7-yl]cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@H]1[C@@H]1c2sccc2-c2cncn21 |
| InChI | InChI=1S/C13H14N2OS/c16-11-3-1-2-9(11)12-13-8(4-5-17-13)10-6-14-7-15(10)12/h4-7,9,11-12,16H,1-3H2/t9-,11+,12-/m1/s1 |
| InChIKey | VTQOVQZDUANBIW-ADEWGFFLSA-N |
| XLogP | 2.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |