C15H18N2OS — CID 130360331
7-(2,2-dimethyloxan-4-yl)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene (PubChem CID 130360331) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 7-(2,2-dimethyloxan-4-yl)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene.
| Compound Name | 7-(2,2-dimethyloxan-4-yl)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene |
|---|---|
| PubChem CID | 130360331 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 7-(2,2-dimethyloxan-4-yl)-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene |
| SMILES | CC1(C)CC(C2c3sccc3-c3cncn32)CCO1 |
| InChI | InChI=1S/C15H18N2OS/c1-15(2)7-10(3-5-18-15)13-14-11(4-6-19-14)12-8-16-9-17(12)13/h4,6,8-10,13H,3,5,7H2,1-2H3 |
| InChIKey | DNFHKXMNFFVPBI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |