C14H14F2N2S — CID 130360317
7-[(1S)-3,3-difluorocyclohexyl]-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene (PubChem CID 130360317) has the molecular formula C14H14F2N2S and a molecular weight of 280.34 g/mol. Its IUPAC name is 7-[(1S)-3,3-difluorocyclohexyl]-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene.
| Compound Name | 7-[(1S)-3,3-difluorocyclohexyl]-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene |
|---|---|
| PubChem CID | 130360317 |
| Molecular Formula | C14H14F2N2S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 7-[(1S)-3,3-difluorocyclohexyl]-9-thia-4,6-diazatricyclo[6.3.0.02,6]undeca-1(8),2,4,10-tetraene |
| SMILES | FC1(F)CCC[C@H](C2c3sccc3-c3cncn32)C1 |
| InChI | InChI=1S/C14H14F2N2S/c15-14(16)4-1-2-9(6-14)12-13-10(3-5-19-13)11-7-17-8-18(11)12/h3,5,7-9,12H,1-2,4,6H2/t9-,12?/m0/s1 |
| InChIKey | ONCPATQLCWBECX-QHGLUPRGSA-N |
| XLogP | 4.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |