C20H13FN2O3 — CID 129283536
2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1,3-benzoxazole-5-carboxamide (PubChem CID 129283536) has the molecular formula C20H13FN2O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 129283536 |
| Molecular Formula | C20H13FN2O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[4-(2-fluorophenyl)phenyl]-N-hydroxy-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2oc(-c3ccc(-c4ccccc4F)cc3)nc2c1 |
| InChI | InChI=1S/C20H13FN2O3/c21-16-4-2-1-3-15(16)12-5-7-13(8-6-12)20-22-17-11-14(19(24)23-25)9-10-18(17)26-20/h1-11,25H,(H,23,24) |
| InChIKey | RTHOMIJNOJGNEL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|