C17H22FN3O5 — CID 129284113
[1-(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)-4-fluoropiperidin-4-yl]methylcarbamic acid (PubChem CID 129284113) has the molecular formula C17H22FN3O5 and a molecular weight of 367.38 g/mol. Its IUPAC name is [1-(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)-4-fluoropiperidin-4-yl]methylcarbamic acid.
| Compound Name | [1-(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)-4-fluoropiperidin-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 129284113 |
| Molecular Formula | C17H22FN3O5 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [1-(2,2-dimethyl-5-nitro-3H-1-benzofuran-6-yl)-4-fluoropiperidin-4-yl]methylcarbamic acid |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(N3CCC(F)(CNC(=O)O)CC3)cc2O1 |
| InChI | InChI=1S/C17H22FN3O5/c1-16(2)9-11-7-13(21(24)25)12(8-14(11)26-16)20-5-3-17(18,4-6-20)10-19-15(22)23/h7-8,19H,3-6,9-10H2,1-2H3,(H,22,23) |
| InChIKey | DJXBXNJABYMWMO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|