About ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine
ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine (PubChem CID 145338536) has the molecular formula C21H38N2O2
and a molecular weight of 350.55 g/mol. Its IUPAC name is ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine.
Molecular Properties
| Compound Name | ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine |
| PubChem CID | 145338536 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine |
| SMILES | CC.CCCN1CCN(c2cc3c(cc2C)CC(C)(C)O3)CC1.CO |
| InChI | InChI=1S/C18H28N2O.C2H6.CH4O/c1-5-6-19-7-9-20(10-8-19)16-12-17-15(11-14(16)2)13-18(3,4)21-17;2*1-2/h11-12H,5-10,13H2,1-4H3;1-2H3;2H,1H3 |
| InChIKey | HPHFXIYMVXFKAU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine?
The IUPAC name of ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine (CID 145338536) is ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine.
What is the SMILES notation for ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine?
The canonical SMILES for ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine is CC.CCCN1CCN(c2cc3c(cc2C)CC(C)(C)O3)CC1.CO.
What is the InChIKey of ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine?
The InChIKey is HPHFXIYMVXFKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O.C2H6.CH4O/c1-5-6-19-7-9-20(10-8-19)16-12-17-15(11-14(16)2)13-18(3,4)21-17;2*1-2/h11-12H,5-10,13H2,1-4H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine?
ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine has a molecular weight of 350.55 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;1-propyl-4-(2,2,5-trimethyl-3H-1-benzofuran-6-yl)piperazine is sourced from PubChem (CID 145338536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).