C17H23F2N3O2 — CID 129298372
N-[6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-3H-1-benzofuran-5-yl]formamide (PubChem CID 129298372) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-3H-1-benzofuran-5-yl]formamide.
| Compound Name | N-[6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-3H-1-benzofuran-5-yl]formamide |
|---|---|
| PubChem CID | 129298372 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-3H-1-benzofuran-5-yl]formamide |
| SMILES | CC1(C)Cc2cc(NC=O)c(N3CCN(CC(F)F)CC3)cc2O1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-17(2)9-12-7-13(20-11-23)14(8-15(12)24-17)22-5-3-21(4-6-22)10-16(18)19/h7-8,11,16H,3-6,9-10H2,1-2H3,(H,20,23) |
| InChIKey | INPNHXACNUPGJX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|