C15H20F2N4O3 — CID 139461628
6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine (PubChem CID 139461628) has the molecular formula C15H20F2N4O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is 6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine.
| Compound Name | 6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 139461628 |
| Molecular Formula | C15H20F2N4O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 6-[4-(2,2-difluoroethyl)piperazin-1-yl]-2,2-dimethyl-5-nitro-3H-furo[2,3-b]pyridine |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])c(N3CCN(CC(F)F)CC3)nc2O1 |
| InChI | InChI=1S/C15H20F2N4O3/c1-15(2)8-10-7-11(21(22)23)13(18-14(10)24-15)20-5-3-19(4-6-20)9-12(16)17/h7,12H,3-6,8-9H2,1-2H3 |
| InChIKey | NAPQPHXLYNZGNG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|