C15H21N3O3 — CID 168870464
1-(2,2-dimethyl-7-nitro-3H-1-benzofuran-4-yl)-4-methylpiperazine (PubChem CID 168870464) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(2,2-dimethyl-7-nitro-3H-1-benzofuran-4-yl)-4-methylpiperazine.
| Compound Name | 1-(2,2-dimethyl-7-nitro-3H-1-benzofuran-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 168870464 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-(2,2-dimethyl-7-nitro-3H-1-benzofuran-4-yl)-4-methylpiperazine |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])c3c2CC(C)(C)O3)CC1 |
| InChI | InChI=1S/C15H21N3O3/c1-15(2)10-11-12(17-8-6-16(3)7-9-17)4-5-13(18(19)20)14(11)21-15/h4-5H,6-10H2,1-3H3 |
| InChIKey | HMEIYSIUSKIMJQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|