C16H22N2O2 — CID 129284594
2-cyclopropyl-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-amine (PubChem CID 129284594) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-cyclopropyl-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-amine.
| Compound Name | 2-cyclopropyl-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 129284594 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-cyclopropyl-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-amine |
| SMILES | CC1(C2CC2)Cc2cc(N)c(N3CCOCC3)cc2O1 |
| InChI | InChI=1S/C16H22N2O2/c1-16(12-2-3-12)10-11-8-13(17)14(9-15(11)20-16)18-4-6-19-7-5-18/h8-9,12H,2-7,10,17H2,1H3 |
| InChIKey | VGMDIKGSQKLVJS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|