C15H19F2N2O5- — CID 163510447
[2-(difluoromethoxymethyl)-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl]-dioxidoazanium (PubChem CID 163510447) has the molecular formula C15H19F2N2O5- and a molecular weight of 345.32 g/mol. Its IUPAC name is [2-(difluoromethoxymethyl)-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl]-dioxidoazanium.
| Compound Name | [2-(difluoromethoxymethyl)-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl]-dioxidoazanium |
|---|---|
| PubChem CID | 163510447 |
| Molecular Formula | C15H19F2N2O5- |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [2-(difluoromethoxymethyl)-2-methyl-6-morpholin-4-yl-3H-1-benzofuran-5-yl]-dioxidoazanium |
| SMILES | CC1(COC(F)F)Cc2cc([NH+]([O-])[O-])c(N3CCOCC3)cc2O1 |
| InChI | InChI=1S/C15H19F2N2O5/c1-15(9-23-14(16)17)8-10-6-12(19(20)21)11(7-13(10)24-15)18-2-4-22-5-3-18/h6-7,14,19H,2-5,8-9H2,1H3/q-1 |
| InChIKey | DCGGXOFHXKPHOB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|