About methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium
methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium (PubChem CID 166004635) has the molecular formula C18H26N3O4+
and a molecular weight of 348.42 g/mol. Its IUPAC name is methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium.
Molecular Properties
| Compound Name | methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium |
| PubChem CID | 166004635 |
| Molecular Formula | C18H26N3O4+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium |
| SMILES | CO[N+](=O)c1cc2c(cc1N1CCOCC1)OC1(CCN(C)CC1)C2 |
| InChI | InChI=1S/C18H26N3O4/c1-19-5-3-18(4-6-19)13-14-11-16(21(22)23-2)15(12-17(14)25-18)20-7-9-24-10-8-20/h11-12H,3-10,13H2,1-2H3/q+1 |
| InChIKey | WYMGXJOAMSFBHF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium?
The IUPAC name of methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium (CID 166004635) is methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium.
What is the SMILES notation for methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium?
The canonical SMILES for methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium is CO[N+](=O)c1cc2c(cc1N1CCOCC1)OC1(CCN(C)CC1)C2.
What is the InChIKey of methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium?
The InChIKey is WYMGXJOAMSFBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N3O4/c1-19-5-3-18(4-6-19)13-14-11-16(21(22)23-2)15(12-17(14)25-18)20-7-9-24-10-8-20/h11-12H,3-10,13H2,1-2H3/q+1.
What are the key properties of methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium?
methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium has a molecular weight of 348.42 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-(1'-methyl-6-morpholin-4-ylspiro[3H-1-benzofuran-2,4'-piperidine]-5-yl)-oxoazanium is sourced from PubChem (CID 166004635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).