C35H42O8 — CID 129285095
ethyl 2-[(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate;ethyl 2-[(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate (PubChem CID 129285095) has the molecular formula C35H42O8 and a molecular weight of 590.71 g/mol. Its IUPAC name is ethyl 2-[(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate;ethyl 2-[(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate.
| Compound Name | ethyl 2-[(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate;ethyl 2-[(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 129285095 |
| Molecular Formula | C35H42O8 |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | ethyl 2-[(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate;ethyl 2-[(6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)oxy]acetate |
| SMILES | CCOC(=O)COC1CCc2cc(O)ccc2C1.CCOC(=O)COC1CCc2cc(OCc3ccccc3)ccc2C1 |
| InChI | InChI=1S/C21H24O4.C14H18O4/c1-2-23-21(22)15-25-20-11-9-17-12-19(10-8-18(17)13-20)24-14-16-6-4-3-5-7-16;1-2-17-14(16)9-18-13-6-4-10-7-12(15)5-3-11(10)8-13/h3-8,10,12,20H,2,9,11,13-15H2,1H3;3,5,7,13,15H,2,4,6,8-9H2,1H3 |
| InChIKey | MXOXEEQBNJEVPF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |