C15H14FN5O — CID 129285325
1-cyano-3-fluoro-N-(1-phenylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 129285325) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-cyano-3-fluoro-N-(1-phenylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-3-fluoro-N-(1-phenylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 129285325 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-cyano-3-fluoro-N-(1-phenylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | N#CN1CCC(F)(C(=O)Nc2cnn(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C15H14FN5O/c16-15(6-7-20(10-15)11-17)14(22)19-12-8-18-21(9-12)13-4-2-1-3-5-13/h1-5,8-9H,6-7,10H2,(H,19,22) |
| InChIKey | IKUKFPCTXAIFDT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|