C19H23N5O — CID 86802633
N-(1-cyanocyclohexyl)-2-[(1-phenylpyrazol-4-yl)amino]propanamide (PubChem CID 86802633) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[(1-phenylpyrazol-4-yl)amino]propanamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[(1-phenylpyrazol-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 86802633 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[(1-phenylpyrazol-4-yl)amino]propanamide |
| SMILES | CC(Nc1cnn(-c2ccccc2)c1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C19H23N5O/c1-15(18(25)23-19(14-20)10-6-3-7-11-19)22-16-12-21-24(13-16)17-8-4-2-5-9-17/h2,4-5,8-9,12-13,15,22H,3,6-7,10-11H2,1H3,(H,23,25) |
| InChIKey | CXTPEKSICSXQLB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |