C17H20N6OS — CID 7762424
(2R)-N-(1-cyanocyclohexyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 7762424) has the molecular formula C17H20N6OS and a molecular weight of 356.46 g/mol. Its IUPAC name is (2R)-N-(1-cyanocyclohexyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(1-cyanocyclohexyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 7762424 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2R)-N-(1-cyanocyclohexyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | C[C@@H](Sc1nnnn1-c1ccccc1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H20N6OS/c1-13(15(24)19-17(12-18)10-6-3-7-11-17)25-16-20-21-22-23(16)14-8-4-2-5-9-14/h2,4-5,8-9,13H,3,6-7,10-11H2,1H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | QHIBYOSYLYNJLE-CYBMUJFWSA-N |
| XLogP | 2.49 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |