C20H29FN4O — CID 71888192
N-(1-cyanocyclohexyl)-2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]propanamide (PubChem CID 71888192) has the molecular formula C20H29FN4O and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]propanamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]propanamide |
|---|---|
| PubChem CID | 71888192 |
| Molecular Formula | C20H29FN4O |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]propanamide |
| SMILES | CC(Nc1ccc(N(C)C(C)C)c(F)c1)C(=O)NC1(C#N)CCCCC1 |
| InChI | InChI=1S/C20H29FN4O/c1-14(2)25(4)18-9-8-16(12-17(18)21)23-15(3)19(26)24-20(13-22)10-6-5-7-11-20/h8-9,12,14-15,23H,5-7,10-11H2,1-4H3,(H,24,26) |
| InChIKey | NJYFZOFQSLKIST-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |