C20H32FN3O — CID 55988900
2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]-N-(4-methylcyclohexyl)propanamide (PubChem CID 55988900) has the molecular formula C20H32FN3O and a molecular weight of 349.49 g/mol. Its IUPAC name is 2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]-N-(4-methylcyclohexyl)propanamide.
| Compound Name | 2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]-N-(4-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 55988900 |
| Molecular Formula | C20H32FN3O |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 2-[3-fluoro-4-[methyl(propan-2-yl)amino]anilino]-N-(4-methylcyclohexyl)propanamide |
| SMILES | CC1CCC(NC(=O)C(C)Nc2ccc(N(C)C(C)C)c(F)c2)CC1 |
| InChI | InChI=1S/C20H32FN3O/c1-13(2)24(5)19-11-10-17(12-18(19)21)22-15(4)20(25)23-16-8-6-14(3)7-9-16/h10-16,22H,6-9H2,1-5H3,(H,23,25) |
| InChIKey | NINAMRIVVZDOBF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |