C22H45NO2 — CID 129287965
1-[2,4-dimethylheptan-3-yl(methyl)amino]ethyl 2,2,4,5-tetramethylhexanoate (PubChem CID 129287965) has the molecular formula C22H45NO2 and a molecular weight of 355.61 g/mol. Its IUPAC name is 1-[2,4-dimethylheptan-3-yl(methyl)amino]ethyl 2,2,4,5-tetramethylhexanoate.
| Compound Name | 1-[2,4-dimethylheptan-3-yl(methyl)amino]ethyl 2,2,4,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 129287965 |
| Molecular Formula | C22H45NO2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.35 |
| IUPAC Name | 1-[2,4-dimethylheptan-3-yl(methyl)amino]ethyl 2,2,4,5-tetramethylhexanoate |
| SMILES | CCCC(C)C(C(C)C)N(C)C(C)OC(=O)C(C)(C)CC(C)C(C)C |
| InChI | InChI=1S/C22H45NO2/c1-12-13-17(6)20(16(4)5)23(11)19(8)25-21(24)22(9,10)14-18(7)15(2)3/h15-20H,12-14H2,1-11H3 |
| InChIKey | TYAPQLULZHPDPJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|