C19H38INO2 — CID 167096368
1-[[2-(1-iodoethyl)-3-methylbutyl]amino]ethyl 2,2,4,5-tetramethylhexanoate (PubChem CID 167096368) has the molecular formula C19H38INO2 and a molecular weight of 439.42 g/mol. Its IUPAC name is 1-[[2-(1-iodoethyl)-3-methylbutyl]amino]ethyl 2,2,4,5-tetramethylhexanoate.
| Compound Name | 1-[[2-(1-iodoethyl)-3-methylbutyl]amino]ethyl 2,2,4,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 167096368 |
| Molecular Formula | C19H38INO2 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[[2-(1-iodoethyl)-3-methylbutyl]amino]ethyl 2,2,4,5-tetramethylhexanoate |
| SMILES | CC(NCC(C(C)C)C(C)I)OC(=O)C(C)(C)CC(C)C(C)C |
| InChI | InChI=1S/C19H38INO2/c1-12(2)14(5)10-19(8,9)18(22)23-16(7)21-11-17(13(3)4)15(6)20/h12-17,21H,10-11H2,1-9H3 |
| InChIKey | HBTQMNMRLYFVAS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|