C62H38N10OS — CID 129290721
10-[5,7-bis(4,6-dipyridin-2-ylpyrimidin-2-yl)-3-phenothiazin-10-ylnaphthalen-1-yl]phenoxazine (PubChem CID 129290721) has the molecular formula C62H38N10OS and a molecular weight of 971.12 g/mol. Its IUPAC name is 10-[5,7-bis(4,6-dipyridin-2-ylpyrimidin-2-yl)-3-phenothiazin-10-ylnaphthalen-1-yl]phenoxazine.
| Compound Name | 10-[5,7-bis(4,6-dipyridin-2-ylpyrimidin-2-yl)-3-phenothiazin-10-ylnaphthalen-1-yl]phenoxazine |
|---|---|
| PubChem CID | 129290721 |
| Molecular Formula | C62H38N10OS |
| Molecular Weight | 971.12 g/mol |
| Exact Mass | 970.30 |
| IUPAC Name | 10-[5,7-bis(4,6-dipyridin-2-ylpyrimidin-2-yl)-3-phenothiazin-10-ylnaphthalen-1-yl]phenoxazine |
| SMILES | c1ccc(-c2cc(-c3ccccn3)nc(-c3cc(-c4nc(-c5ccccn5)cc(-c5ccccn5)n4)c4cc(N5c6ccccc6Sc6ccccc65)cc(N5c6ccccc6Oc6ccccc65)c4c3)n2)nc1 |
| InChI | InChI=1S/C62H38N10OS/c1-5-25-57-52(21-1)72(53-22-2-6-26-58(53)73-57)56-36-40(71-54-23-3-7-27-59(54)74-60-28-8-4-24-55(60)71)35-41-42(56)33-39(61-67-48(44-17-9-13-29-63-44)37-49(68-61)45-18-10-14-30-64-45)34-43(41)62-69-50(46-19-11-15-31-65-46)38-51(70-62)47-20-12-16-32-66-47/h1-38H |
| InChIKey | BAOHWDUBGCXTAF-UHFFFAOYSA-N |
| XLogP | 15.51 |
| TPSA | 118.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.12 |
| LogP ≤ 5 | 15.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |