C18H36N4O2+2 — CID 129292850
N-[6-(methylamino)hexyl]-2-[4-(2-oxopropyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]acetamide (PubChem CID 129292850) has the molecular formula C18H36N4O2+2 and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[6-(methylamino)hexyl]-2-[4-(2-oxopropyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]acetamide.
| Compound Name | N-[6-(methylamino)hexyl]-2-[4-(2-oxopropyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]acetamide |
|---|---|
| PubChem CID | 129292850 |
| Molecular Formula | C18H36N4O2+2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | N-[6-(methylamino)hexyl]-2-[4-(2-oxopropyl)-1,4-diazoniabicyclo[2.2.2]octan-1-yl]acetamide |
| SMILES | CNCCCCCCNC(=O)C[N+]12CC[N+](CC(C)=O)(CC1)CC2 |
| InChI | InChI=1S/C18H35N4O2/c1-17(23)15-21-9-12-22(13-10-21,14-11-21)16-18(24)20-8-6-4-3-5-7-19-2/h19H,3-16H2,1-2H3/q+1/p+1 |
| InChIKey | HUDMIVQBQUHQIC-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|