C24H30O8 — CID 129292856
4-[2-(11,13-dihydroxy-10-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoic acid (PubChem CID 129292856) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[2-(11,13-dihydroxy-10-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-(11,13-dihydroxy-10-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 129292856 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-[2-(11,13-dihydroxy-10-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethoxy]-4-oxobutanoic acid |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(O)C(C(=O)COC(=O)CCC(=O)O)CCC12 |
| InChI | InChI=1S/C24H30O8/c1-23-9-8-14(25)10-13(23)2-3-15-16-4-5-17(24(16,31)11-18(26)22(15)23)19(27)12-32-21(30)7-6-20(28)29/h8-10,15-18,22,26,31H,2-7,11-12H2,1H3,(H,28,29) |
| InChIKey | XJFRRAMYJLPJIR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |