C19H21Br2NO3 — CID 129301985
5-bromo-2-[2-[2-[(5-bromo-2,3-dihydro-1H-inden-2-yl)oxy]ethoxy]ethoxymethyl]pyridine (PubChem CID 129301985) has the molecular formula C19H21Br2NO3 and a molecular weight of 471.19 g/mol. Its IUPAC name is 5-bromo-2-[2-[2-[(5-bromo-2,3-dihydro-1H-inden-2-yl)oxy]ethoxy]ethoxymethyl]pyridine.
| Compound Name | 5-bromo-2-[2-[2-[(5-bromo-2,3-dihydro-1H-inden-2-yl)oxy]ethoxy]ethoxymethyl]pyridine |
|---|---|
| PubChem CID | 129301985 |
| Molecular Formula | C19H21Br2NO3 |
| Molecular Weight | 471.19 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 5-bromo-2-[2-[2-[(5-bromo-2,3-dihydro-1H-inden-2-yl)oxy]ethoxy]ethoxymethyl]pyridine |
| SMILES | Brc1ccc(COCCOCCOC2Cc3ccc(Br)cc3C2)nc1 |
| InChI | InChI=1S/C19H21Br2NO3/c20-16-2-1-14-10-19(11-15(14)9-16)25-8-7-23-5-6-24-13-18-4-3-17(21)12-22-18/h1-4,9,12,19H,5-8,10-11,13H2 |
| InChIKey | YRYBQCJNZLBXCM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|