C34H44O2 — CID 129304681
(8S,11R,13S,14S,17S)-11-(4-tert-butylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304681) has the molecular formula C34H44O2 and a molecular weight of 484.72 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(4-tert-butylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(4-tert-butylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304681 |
| Molecular Formula | C34H44O2 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(4-tert-butylphenyl)-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)(C)C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(C(C)(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H44O2/c1-31(2,3)18-19-34(36)17-16-29-27-14-10-23-20-25(35)13-15-26(23)30(27)28(21-33(29,34)7)22-8-11-24(12-9-22)32(4,5)6/h8-9,11-12,20,27-29,36H,10,13-17,21H2,1-7H3/t27-,28+,29-,33-,34+/m0/s1 |
| InChIKey | RVGSLSJAEVNSEX-WMQBTLKUSA-N |
| XLogP | 7.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|