C36H46N2O3 — CID 129304706
(8S,11R,13S,14S,17S)-11-[4-(4-acetylpiperazin-1-yl)phenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304706) has the molecular formula C36H46N2O3 and a molecular weight of 554.78 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-[4-(4-acetylpiperazin-1-yl)phenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-[4-(4-acetylpiperazin-1-yl)phenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304706 |
| Molecular Formula | C36H46N2O3 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-[4-(4-acetylpiperazin-1-yl)phenyl]-17-(3,3-dimethylbut-1-ynyl)-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)N1CCN(c2ccc([C@H]3C[C@@]4(C)[C@@H](CC[C@@]4(O)C#CC(C)(C)C)[C@@H]4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C36H46N2O3/c1-24(39)37-18-20-38(21-19-37)27-9-6-25(7-10-27)31-23-35(5)32(14-15-36(35,41)17-16-34(2,3)4)30-12-8-26-22-28(40)11-13-29(26)33(30)31/h6-7,9-10,22,30-32,41H,8,11-15,18-21,23H2,1-5H3/t30-,31+,32-,35-,36+/m0/s1 |
| InChIKey | FGYWLKRYNSJELE-SSYXQGICSA-N |
| XLogP | 6.04 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|