C21H18ClF8N5O2 — CID 129306041
[2-chloro-5-[1-[1-methyl-3-(2,2,3,3,3-pentafluoropropoxy)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-(cyclopropylamino)methanol (PubChem CID 129306041) has the molecular formula C21H18ClF8N5O2 and a molecular weight of 559.85 g/mol. Its IUPAC name is [2-chloro-5-[1-[1-methyl-3-(2,2,3,3,3-pentafluoropropoxy)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-(cyclopropylamino)methanol.
| Compound Name | [2-chloro-5-[1-[1-methyl-3-(2,2,3,3,3-pentafluoropropoxy)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-(cyclopropylamino)methanol |
|---|---|
| PubChem CID | 129306041 |
| Molecular Formula | C21H18ClF8N5O2 |
| Molecular Weight | 559.85 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | [2-chloro-5-[1-[1-methyl-3-(2,2,3,3,3-pentafluoropropoxy)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]phenyl]-(cyclopropylamino)methanol |
| SMILES | Cn1nc(OCC(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(-c2ccc(Cl)c(C(O)NC3CC3)c2)cn1 |
| InChI | InChI=1S/C21H18ClF8N5O2/c1-34-18(15(20(25,26)27)17(33-34)37-9-19(23,24)21(28,29)30)35-8-11(7-31-35)10-2-5-14(22)13(6-10)16(36)32-12-3-4-12/h2,5-8,12,16,32,36H,3-4,9H2,1H3 |
| InChIKey | DQNSDMAMBHGELT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.85 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|