C34H30N2 — CID 129310561
16-[4-(1,2-dihydropyridin-2-yl)phenyl]-14,14-dimethyl-1-azapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8(13),9,15,17,19,21-nonaene (PubChem CID 129310561) has the molecular formula C34H30N2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 16-[4-(1,2-dihydropyridin-2-yl)phenyl]-14,14-dimethyl-1-azapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8(13),9,15,17,19,21-nonaene.
| Compound Name | 16-[4-(1,2-dihydropyridin-2-yl)phenyl]-14,14-dimethyl-1-azapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8(13),9,15,17,19,21-nonaene |
|---|---|
| PubChem CID | 129310561 |
| Molecular Formula | C34H30N2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 16-[4-(1,2-dihydropyridin-2-yl)phenyl]-14,14-dimethyl-1-azapentacyclo[13.7.0.02,7.08,13.017,22]docosa-2,4,6,8(13),9,15,17,19,21-nonaene |
| SMILES | CC1(C)C2=C(C=CCC2)c2ccccc2-n2c1c(-c1ccc(C3C=CC=CN3)cc1)c1ccccc12 |
| InChI | InChI=1S/C34H30N2/c1-34(2)28-14-6-3-11-25(28)26-12-4-7-16-30(26)36-31-17-8-5-13-27(31)32(33(34)36)24-20-18-23(19-21-24)29-15-9-10-22-35-29/h3-5,7-13,15-22,29,35H,6,14H2,1-2H3 |
| InChIKey | BNRBBGKCMQOGNA-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |