C16H23N — CID 129311864
2-[1-(3,5-dimethylphenyl)cyclopentyl]-N-methylethanimine (PubChem CID 129311864) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-[1-(3,5-dimethylphenyl)cyclopentyl]-N-methylethanimine.
| Compound Name | 2-[1-(3,5-dimethylphenyl)cyclopentyl]-N-methylethanimine |
|---|---|
| PubChem CID | 129311864 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2-[1-(3,5-dimethylphenyl)cyclopentyl]-N-methylethanimine |
| SMILES | C/N=C/CC1(c2cc(C)cc(C)c2)CCCC1 |
| InChI | InChI=1S/C16H23N/c1-13-10-14(2)12-15(11-13)16(8-9-17-3)6-4-5-7-16/h9-12H,4-8H2,1-3H3/b17-9+ |
| InChIKey | UQFDYDFSUIBYSR-RQZCQDPDSA-N |
| XLogP | 4.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|