C22H28O3 — CID 170054066
4-[1-(3,5-dimethylphenyl)cyclohexyl]-2,6-bis(hydroxymethyl)phenol (PubChem CID 170054066) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 4-[1-(3,5-dimethylphenyl)cyclohexyl]-2,6-bis(hydroxymethyl)phenol.
| Compound Name | 4-[1-(3,5-dimethylphenyl)cyclohexyl]-2,6-bis(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 170054066 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-[1-(3,5-dimethylphenyl)cyclohexyl]-2,6-bis(hydroxymethyl)phenol |
| SMILES | Cc1cc(C)cc(C2(c3cc(CO)c(O)c(CO)c3)CCCCC2)c1 |
| InChI | InChI=1S/C22H28O3/c1-15-8-16(2)10-19(9-15)22(6-4-3-5-7-22)20-11-17(13-23)21(25)18(12-20)14-24/h8-12,23-25H,3-7,13-14H2,1-2H3 |
| InChIKey | ZMUHMUPQIKPBMD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |