C23H37NO6 — CID 129316748
(1S,2R,3S,5S,8R,13S,17S)-11-ethyl-13-(hydroxymethyl)-6,18-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,16-triol (PubChem CID 129316748) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is (1S,2R,3S,5S,8R,13S,17S)-11-ethyl-13-(hydroxymethyl)-6,18-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,16-triol.
| Compound Name | (1S,2R,3S,5S,8R,13S,17S)-11-ethyl-13-(hydroxymethyl)-6,18-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,16-triol |
|---|---|
| PubChem CID | 129316748 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (1S,2R,3S,5S,8R,13S,17S)-11-ethyl-13-(hydroxymethyl)-6,18-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,16-triol |
| SMILES | CCN1C[C@]2(CO)CCC(O)[C@]34C1C(C(OC)[C@@H]23)[C@@]1(O)CC(OC)[C@H]2C[C@@H]4[C@H]1C2O |
| InChI | InChI=1S/C23H37NO6/c1-4-24-9-21(10-25)6-5-14(26)23-12-7-11-13(29-2)8-22(28,15(12)17(11)27)16(20(23)24)18(30-3)19(21)23/h11-20,25-28H,4-10H2,1-3H3/t11-,12-,13?,14?,15+,16?,17?,18?,19+,20?,21+,22-,23+/m1/s1 |
| InChIKey | RQCXQGUVPFYJCE-XSNMHXMKSA-N |
| XLogP | -0.15 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |