C10H20NO5PS2 — CID 129318199
ethyl N-[2-[bis(1,1,2,2,2-pentadeuterioethoxy)phosphinothioylsulfanyl]acetyl]-N-methylcarbamate (PubChem CID 129318199) has the molecular formula C10H20NO5PS2 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl N-[2-[bis(1,1,2,2,2-pentadeuterioethoxy)phosphinothioylsulfanyl]acetyl]-N-methylcarbamate.
| Compound Name | ethyl N-[2-[bis(1,1,2,2,2-pentadeuterioethoxy)phosphinothioylsulfanyl]acetyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 129318199 |
| Molecular Formula | C10H20NO5PS2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | ethyl N-[2-[bis(1,1,2,2,2-pentadeuterioethoxy)phosphinothioylsulfanyl]acetyl]-N-methylcarbamate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=S)(OC([2H])([2H])C([2H])([2H])[2H])SCC(=O)N(C)C(=O)OCC |
| InChI | InChI=1S/C10H20NO5PS2/c1-5-14-10(13)11(4)9(12)8-19-17(18,15-6-2)16-7-3/h5-8H2,1-4H3/i2D3,3D3,6D2,7D2 |
| InChIKey | KLGMSAOQDHLCOS-PUVRZNKUSA-N |
| XLogP | 2.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|