C4H14NO3PS — CID 171380944
azane;hydroxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-λ5-phosphane (PubChem CID 171380944) has the molecular formula C4H14NO3PS and a molecular weight of 197.26 g/mol. Its IUPAC name is azane;hydroxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-λ5-phosphane.
| Compound Name | azane;hydroxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 171380944 |
| Molecular Formula | C4H14NO3PS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | azane;hydroxy-bis(1,1,2,2,2-pentadeuterioethoxy)-sulfanylidene-λ5-phosphane |
| SMILES | N.[2H]C([2H])([2H])C([2H])([2H])OP(O)(=S)OC([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C4H11O3PS.H3N/c1-3-6-8(5,9)7-4-2;/h3-4H2,1-2H3,(H,5,9);1H3/i1D3,2D3,3D2,4D2; |
| InChIKey | IBGKZCJDWXXWNU-MFMGRUKYSA-N |
| XLogP | 1.44 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|