C10H26NO3PS — CID 173276202
diethoxy-hydroxy-sulfanylidene-λ5-phosphane;N,N-diethylethanamine (PubChem CID 173276202) has the molecular formula C10H26NO3PS and a molecular weight of 271.36 g/mol. Its IUPAC name is diethoxy-hydroxy-sulfanylidene-λ5-phosphane;N,N-diethylethanamine.
| Compound Name | diethoxy-hydroxy-sulfanylidene-λ5-phosphane;N,N-diethylethanamine |
|---|---|
| PubChem CID | 173276202 |
| Molecular Formula | C10H26NO3PS |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | diethoxy-hydroxy-sulfanylidene-λ5-phosphane;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.CCOP(O)(=S)OCC |
| InChI | InChI=1S/C6H15N.C4H11O3PS/c1-4-7(5-2)6-3;1-3-6-8(5,9)7-4-2/h4-6H2,1-3H3;3-4H2,1-2H3,(H,5,9) |
| InChIKey | GKYWIWVZVSCTHQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|