About [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium
[diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium (PubChem CID 172865589) has the molecular formula C10H25NO3PS+
and a molecular weight of 270.35 g/mol. Its IUPAC name is [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium.
Molecular Properties
| Compound Name | [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium |
| PubChem CID | 172865589 |
| Molecular Formula | C10H25NO3PS+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium |
| SMILES | CCOP(O)(OCC)=[S+]CCN(CC)CC |
| InChI | InChI=1S/C10H25NO3PS/c1-5-11(6-2)9-10-16-15(12,13-7-3)14-8-4/h12H,5-10H2,1-4H3/q+1 |
| InChIKey | ZYDIPFWONPCKGB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium?
The IUPAC name of [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium (CID 172865589) is [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium.
What is the SMILES notation for [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium?
The canonical SMILES for [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium is CCOP(O)(OCC)=[S+]CCN(CC)CC.
What is the InChIKey of [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium?
The InChIKey is ZYDIPFWONPCKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25NO3PS/c1-5-11(6-2)9-10-16-15(12,13-7-3)14-8-4/h12H,5-10H2,1-4H3/q+1.
What are the key properties of [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium?
[diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium has a molecular weight of 270.35 g/mol, XLogP of 2.15, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [diethoxy(hydroxy)-λ5-phosphanylidene]-[2-(diethylamino)ethyl]sulfanium is sourced from PubChem (CID 172865589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).