C13H30NO6PS — CID 87674337
carbonic acid;2-diethoxyphosphorylsulfanyl-N,N-diethylethanamine;ethene (PubChem CID 87674337) has the molecular formula C13H30NO6PS and a molecular weight of 359.43 g/mol. Its IUPAC name is carbonic acid;2-diethoxyphosphorylsulfanyl-N,N-diethylethanamine;ethene.
| Compound Name | carbonic acid;2-diethoxyphosphorylsulfanyl-N,N-diethylethanamine;ethene |
|---|---|
| PubChem CID | 87674337 |
| Molecular Formula | C13H30NO6PS |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | carbonic acid;2-diethoxyphosphorylsulfanyl-N,N-diethylethanamine;ethene |
| SMILES | C=C.CCOP(=O)(OCC)SCCN(CC)CC.O=C(O)O |
| InChI | InChI=1S/C10H24NO3PS.C2H4.CH2O3/c1-5-11(6-2)9-10-16-15(12,13-7-3)14-8-4;1-2;2-1(3)4/h5-10H2,1-4H3;1-2H2;(H2,2,3,4) |
| InChIKey | UCMYPRQHLAPNPV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|