C17H38NO2PS — CID 559681
2-[decoxy(methyl)phosphoryl]sulfanyl-N,N-diethylethanamine (PubChem CID 559681) has the molecular formula C17H38NO2PS and a molecular weight of 351.54 g/mol. Its IUPAC name is 2-[decoxy(methyl)phosphoryl]sulfanyl-N,N-diethylethanamine.
| Compound Name | 2-[decoxy(methyl)phosphoryl]sulfanyl-N,N-diethylethanamine |
|---|---|
| PubChem CID | 559681 |
| Molecular Formula | C17H38NO2PS |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-[decoxy(methyl)phosphoryl]sulfanyl-N,N-diethylethanamine |
| SMILES | CCCCCCCCCCOP(C)(=O)SCCN(CC)CC |
| InChI | InChI=1S/C17H38NO2PS/c1-5-8-9-10-11-12-13-14-16-20-21(4,19)22-17-15-18(6-2)7-3/h5-17H2,1-4H3 |
| InChIKey | FATXKBYWVUNDBG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|