[1-amino-2-(4-fluorophenyl)ethyl]boronic acid

C8H11BFNO2 — CID 129319389

IUPAC[1-amino-2-(4-fluorophenyl)ethyl]boronic acid
SMILESNC(Cc1ccc(F)cc1)B(O)O
InChIInChI=1S/C8H11BFNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,12-13H,5,11H2
InChIKeyFRAXJAASBRZNBB-UHFFFAOYSA-N
MW182.99 g/mol
LogP-0.29
Rot. Bonds3

About [1-amino-2-(4-fluorophenyl)ethyl]boronic acid

[1-amino-2-(4-fluorophenyl)ethyl]boronic acid (PubChem CID 129319389) has the molecular formula C8H11BFNO2 and a molecular weight of 182.99 g/mol. Its IUPAC name is [1-amino-2-(4-fluorophenyl)ethyl]boronic acid.

Molecular Properties

Compound Name[1-amino-2-(4-fluorophenyl)ethyl]boronic acid
PubChem CID129319389
Molecular FormulaC8H11BFNO2
Molecular Weight182.99 g/mol
Exact Mass183.09
IUPAC Name[1-amino-2-(4-fluorophenyl)ethyl]boronic acid
SMILESNC(Cc1ccc(F)cc1)B(O)O
InChIInChI=1S/C8H11BFNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,12-13H,5,11H2
InChIKeyFRAXJAASBRZNBB-UHFFFAOYSA-N
XLogP-0.29
TPSA66.48 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.99
LogP ≤ 5-0.29
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [1-amino-2-(4-fluorophenyl)ethyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-amino-2-(4-fluorophenyl)ethyl]boronic acid?
The IUPAC name of [1-amino-2-(4-fluorophenyl)ethyl]boronic acid (CID 129319389) is [1-amino-2-(4-fluorophenyl)ethyl]boronic acid.
What is the SMILES notation for [1-amino-2-(4-fluorophenyl)ethyl]boronic acid?
The canonical SMILES for [1-amino-2-(4-fluorophenyl)ethyl]boronic acid is NC(Cc1ccc(F)cc1)B(O)O.
What is the InChIKey of [1-amino-2-(4-fluorophenyl)ethyl]boronic acid?
The InChIKey is FRAXJAASBRZNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BFNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,12-13H,5,11H2.
What are the key properties of [1-amino-2-(4-fluorophenyl)ethyl]boronic acid?
[1-amino-2-(4-fluorophenyl)ethyl]boronic acid has a molecular weight of 182.99 g/mol, XLogP of -0.29, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-2-(4-fluorophenyl)ethyl]boronic acid is sourced from PubChem (CID 129319389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).