C18H22BFN2O3 — CID 71563105
[(2R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-fluorophenyl)propan-2-yl]boronic acid (PubChem CID 71563105) has the molecular formula C18H22BFN2O3 and a molecular weight of 344.20 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-fluorophenyl)propan-2-yl]boronic acid.
| Compound Name | [(2R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-fluorophenyl)propan-2-yl]boronic acid |
|---|---|
| PubChem CID | 71563105 |
| Molecular Formula | C18H22BFN2O3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [(2R)-1-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-(4-fluorophenyl)propan-2-yl]boronic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NC[C@@H](Cc1ccc(F)cc1)B(O)O |
| InChI | InChI=1S/C18H22BFN2O3/c20-16-8-6-14(7-9-16)10-15(19(24)25)12-22-18(23)17(21)11-13-4-2-1-3-5-13/h1-9,15,17,24-25H,10-12,21H2,(H,22,23)/t15-,17+/m1/s1 |
| InChIKey | WRTCOSYATOWYQV-WBVHZDCISA-N |
| XLogP | 0.90 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|