C15H26BClFN3O3 — CID 86576348
[(2S)-6-amino-1-[[2-borono-3-(4-fluorophenyl)propyl]amino]-1-oxohexan-2-yl]azanium chloride (PubChem CID 86576348) has the molecular formula C15H26BClFN3O3 and a molecular weight of 361.65 g/mol. Its IUPAC name is [(2S)-6-amino-1-[[2-borono-3-(4-fluorophenyl)propyl]amino]-1-oxohexan-2-yl]azanium chloride.
| Compound Name | [(2S)-6-amino-1-[[2-borono-3-(4-fluorophenyl)propyl]amino]-1-oxohexan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 86576348 |
| Molecular Formula | C15H26BClFN3O3 |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [(2S)-6-amino-1-[[2-borono-3-(4-fluorophenyl)propyl]amino]-1-oxohexan-2-yl]azanium chloride |
| SMILES | NCCCC[C@H]([NH3+])C(=O)NCC(Cc1ccc(F)cc1)B(O)O.[Cl-] |
| InChI | InChI=1S/C15H25BFN3O3.ClH/c17-13-6-4-11(5-7-13)9-12(16(22)23)10-20-15(21)14(19)3-1-2-8-18;/h4-7,12,14,22-23H,1-3,8-10,18-19H2,(H,20,21);1H/t12?,14-;/m0./s1 |
| InChIKey | WDFACSQHIRKEPA-KQYRMMKASA-N |
| XLogP | -3.93 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|