C16H25BF3N3O4 — CID 71563107
[(2R)-1-[[(2R)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid (PubChem CID 71563107) has the molecular formula C16H25BF3N3O4 and a molecular weight of 391.20 g/mol. Its IUPAC name is [(2R)-1-[[(2R)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid.
| Compound Name | [(2R)-1-[[(2R)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid |
|---|---|
| PubChem CID | 71563107 |
| Molecular Formula | C16H25BF3N3O4 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [(2R)-1-[[(2R)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid |
| SMILES | NCCCC[C@@H](N)C(=O)NC[C@@H](Cc1ccc(OC(F)(F)F)cc1)B(O)O |
| InChI | InChI=1S/C16H25BF3N3O4/c18-16(19,20)27-13-6-4-11(5-7-13)9-12(17(25)26)10-23-15(24)14(22)3-1-2-8-21/h4-7,12,14,25-26H,1-3,8-10,21-22H2,(H,23,24)/t12-,14-/m1/s1 |
| InChIKey | SUPKFEXYEPZRPP-TZMCWYRMSA-N |
| XLogP | 0.54 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|