C21H25Cl2F3N6O2 — CID 170158240
2,6-diamino-N-[4-[3-[4-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]hexanamide;dihydrochloride (PubChem CID 170158240) has the molecular formula C21H25Cl2F3N6O2 and a molecular weight of 521.37 g/mol. Its IUPAC name is 2,6-diamino-N-[4-[3-[4-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]hexanamide;dihydrochloride.
| Compound Name | 2,6-diamino-N-[4-[3-[4-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]hexanamide;dihydrochloride |
|---|---|
| PubChem CID | 170158240 |
| Molecular Formula | C21H25Cl2F3N6O2 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2,6-diamino-N-[4-[3-[4-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]hexanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCC(N)C(=O)Nc1ccc(-c2nc(-c3ccc(OC(F)(F)F)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C21H23F3N6O2.2ClH/c22-21(23,24)32-16-10-6-14(7-11-16)19-28-18(29-30-19)13-4-8-15(9-5-13)27-20(31)17(26)3-1-2-12-25;;/h4-11,17H,1-3,12,25-26H2,(H,27,31)(H,28,29,30);2*1H |
| InChIKey | CKNCNQRUJDWXKU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|