C16H27BCl2F3N3O4 — CID 71666534
[(2R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid;dihydrochloride (PubChem CID 71666534) has the molecular formula C16H27BCl2F3N3O4 and a molecular weight of 464.12 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid;dihydrochloride.
| Compound Name | [(2R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid;dihydrochloride |
|---|---|
| PubChem CID | 71666534 |
| Molecular Formula | C16H27BCl2F3N3O4 |
| Molecular Weight | 464.12 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [(2R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-3-[4-(trifluoromethoxy)phenyl]propan-2-yl]boronic acid;dihydrochloride |
| SMILES | Cl.Cl.NCCCC[C@H](N)C(=O)NC[C@@H](Cc1ccc(OC(F)(F)F)cc1)B(O)O |
| InChI | InChI=1S/C16H25BF3N3O4.2ClH/c18-16(19,20)27-13-6-4-11(5-7-13)9-12(17(25)26)10-23-15(24)14(22)3-1-2-8-21;;/h4-7,12,14,25-26H,1-3,8-10,21-22H2,(H,23,24);2*1H/t12-,14+;;/m1../s1 |
| InChIKey | JVLFBUUYBYHARC-DAIKJZOUSA-N |
| XLogP | 1.39 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.12 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|