C12H18ClNO3 — CID 129319949
(3R)-3-(3,4-dimethoxyphenoxy)pyrrolidine;hydrochloride (PubChem CID 129319949) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is (3R)-3-(3,4-dimethoxyphenoxy)pyrrolidine;hydrochloride.
| Compound Name | (3R)-3-(3,4-dimethoxyphenoxy)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 129319949 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (3R)-3-(3,4-dimethoxyphenoxy)pyrrolidine;hydrochloride |
| SMILES | COc1ccc(O[C@@H]2CCNC2)cc1OC.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-14-11-4-3-9(7-12(11)15-2)16-10-5-6-13-8-10;/h3-4,7,10,13H,5-6,8H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | RFWFEALALUHTFM-HNCPQSOCSA-N |
| XLogP | 1.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |