C11H18O — CID 129321208
[(1R,3R,4R,7R)-3-tricyclo[5.3.0.01,4]decanyl]methanol (PubChem CID 129321208) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is [(1R,3R,4R,7R)-3-tricyclo[5.3.0.01,4]decanyl]methanol.
| Compound Name | [(1R,3R,4R,7R)-3-tricyclo[5.3.0.01,4]decanyl]methanol |
|---|---|
| PubChem CID | 129321208 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | [(1R,3R,4R,7R)-3-tricyclo[5.3.0.01,4]decanyl]methanol |
| SMILES | OC[C@@H]1C[C@]23CCC[C@@H]2CC[C@H]13 |
| InChI | InChI=1S/C11H18O/c12-7-8-6-11-5-1-2-9(11)3-4-10(8)11/h8-10,12H,1-7H2/t8-,9+,10+,11+/m0/s1 |
| InChIKey | MECZBDGLSCELFC-LNFKQOIKSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |